C17H32N2 — CID 67813057
N,N-dimethylaniline;N,N-dipropylpropan-1-amine (PubChem CID 67813057) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N,N-dimethylaniline;N,N-dipropylpropan-1-amine.
| Compound Name | N,N-dimethylaniline;N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 67813057 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N,N-dimethylaniline;N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC.CN(C)c1ccccc1 |
| InChI | InChI=1S/C9H21N.C8H11N/c1-4-7-10(8-5-2)9-6-3;1-9(2)8-6-4-3-5-7-8/h4-9H2,1-3H3;3-7H,1-2H3 |
| InChIKey | BXKYJEDOCRLXBH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |