About N,N-dipropylpropan-1-amine;toluene
N,N-dipropylpropan-1-amine;toluene (PubChem CID 142167047) has the molecular formula C16H29N
and a molecular weight of 235.42 g/mol. Its IUPAC name is N,N-dipropylpropan-1-amine;toluene.
Molecular Properties
| Compound Name | N,N-dipropylpropan-1-amine;toluene |
| PubChem CID | 142167047 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N,N-dipropylpropan-1-amine;toluene |
| SMILES | CCCN(CCC)CCC.Cc1ccccc1 |
| InChI | InChI=1S/C9H21N.C7H8/c1-4-7-10(8-5-2)9-6-3;1-7-5-3-2-4-6-7/h4-9H2,1-3H3;2-6H,1H3 |
| InChIKey | XHANQHULLRTETB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dipropylpropan-1-amine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylpropan-1-amine;toluene?
The IUPAC name of N,N-dipropylpropan-1-amine;toluene (CID 142167047) is N,N-dipropylpropan-1-amine;toluene.
What is the SMILES notation for N,N-dipropylpropan-1-amine;toluene?
The canonical SMILES for N,N-dipropylpropan-1-amine;toluene is CCCN(CCC)CCC.Cc1ccccc1.
What is the InChIKey of N,N-dipropylpropan-1-amine;toluene?
The InChIKey is XHANQHULLRTETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C7H8/c1-4-7-10(8-5-2)9-6-3;1-7-5-3-2-4-6-7/h4-9H2,1-3H3;2-6H,1H3.
What are the key properties of N,N-dipropylpropan-1-amine;toluene?
N,N-dipropylpropan-1-amine;toluene has a molecular weight of 235.42 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylpropan-1-amine;toluene is sourced from PubChem (CID 142167047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).