About N,N-dimethylaniline;hydrofluoride
N,N-dimethylaniline;hydrofluoride (PubChem CID 160775229) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is N,N-dimethylaniline;hydrofluoride.
Molecular Properties
| Compound Name | N,N-dimethylaniline;hydrofluoride |
| PubChem CID | 160775229 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | N,N-dimethylaniline;hydrofluoride |
| SMILES | CN(C)c1ccccc1.F |
| InChI | InChI=1S/C8H11N.FH/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H |
| InChIKey | RZVXHCLKFPNDTO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylaniline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;hydrofluoride?
The IUPAC name of N,N-dimethylaniline;hydrofluoride (CID 160775229) is N,N-dimethylaniline;hydrofluoride.
What is the SMILES notation for N,N-dimethylaniline;hydrofluoride?
The canonical SMILES for N,N-dimethylaniline;hydrofluoride is CN(C)c1ccccc1.F.
What is the InChIKey of N,N-dimethylaniline;hydrofluoride?
The InChIKey is RZVXHCLKFPNDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.FH/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H.
What are the key properties of N,N-dimethylaniline;hydrofluoride?
N,N-dimethylaniline;hydrofluoride has a molecular weight of 141.19 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;hydrofluoride is sourced from PubChem (CID 160775229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).