About CID 69241188
CID 69241188 (PubChem CID 69241188) has the molecular formula C8H11LiN
and a molecular weight of 128.12 g/mol.
Molecular Properties
| Compound Name | CID 69241188 |
| PubChem CID | 69241188 |
| Molecular Formula | C8H11LiN |
| Molecular Weight | 128.12 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccccc1.[Li] |
| InChI | InChI=1S/C8H11N.Li/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3; |
| InChIKey | JOEGVCMVOWOJIC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 69241188 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69241188?
The IUPAC name of CID 69241188 (CID 69241188) is not available.
What is the SMILES notation for CID 69241188?
The canonical SMILES for CID 69241188 is CN(C)c1ccccc1.[Li].
What is the InChIKey of CID 69241188?
The InChIKey is JOEGVCMVOWOJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.Li/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;.
What are the key properties of CID 69241188?
CID 69241188 has a molecular weight of 128.12 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69241188 is sourced from PubChem (CID 69241188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).