About N,N-dimethylaniline;osmium(4+)
N,N-dimethylaniline;osmium(4+) (PubChem CID 172845967) has the molecular formula C8H11NOs+4
and a molecular weight of 311.41 g/mol. Its IUPAC name is N,N-dimethylaniline;osmium(4+).
Molecular Properties
| Compound Name | N,N-dimethylaniline;osmium(4+) |
| PubChem CID | 172845967 |
| Molecular Formula | C8H11NOs+4 |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N,N-dimethylaniline;osmium(4+) |
| SMILES | CN(C)c1ccccc1.[Os+4] |
| InChI | InChI=1S/C8H11N.Os/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;/q;+4 |
| InChIKey | XKRGHQVOUBAFFG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylaniline;osmium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;osmium(4+)?
The IUPAC name of N,N-dimethylaniline;osmium(4+) (CID 172845967) is N,N-dimethylaniline;osmium(4+).
What is the SMILES notation for N,N-dimethylaniline;osmium(4+)?
The canonical SMILES for N,N-dimethylaniline;osmium(4+) is CN(C)c1ccccc1.[Os+4].
What is the InChIKey of N,N-dimethylaniline;osmium(4+)?
The InChIKey is XKRGHQVOUBAFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.Os/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;/q;+4.
What are the key properties of N,N-dimethylaniline;osmium(4+)?
N,N-dimethylaniline;osmium(4+) has a molecular weight of 311.41 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;osmium(4+) is sourced from PubChem (CID 172845967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).