carbon monoxide;N,N-dimethylaniline;tungsten

C11H11NO3W — CID 134981716

IUPACcarbon monoxide;N,N-dimethylaniline;tungsten
SMILESCN(C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C8H11N.3CO.W/c1-9(2)8-6-4-3-5-7-8;3*1-2;/h3-7H,1-2H3;;;;
InChIKeyUMZINCJUKOFMLU-UHFFFAOYSA-N
MW389.05 g/mol
LogP1.64
Rot. Bonds1

About carbon monoxide;N,N-dimethylaniline;tungsten

carbon monoxide;N,N-dimethylaniline;tungsten (PubChem CID 134981716) has the molecular formula C11H11NO3W and a molecular weight of 389.05 g/mol. Its IUPAC name is carbon monoxide;N,N-dimethylaniline;tungsten.

Molecular Properties

Compound Namecarbon monoxide;N,N-dimethylaniline;tungsten
PubChem CID134981716
Molecular FormulaC11H11NO3W
Molecular Weight389.05 g/mol
Exact Mass389.02
IUPAC Namecarbon monoxide;N,N-dimethylaniline;tungsten
SMILESCN(C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C8H11N.3CO.W/c1-9(2)8-6-4-3-5-7-8;3*1-2;/h3-7H,1-2H3;;;;
InChIKeyUMZINCJUKOFMLU-UHFFFAOYSA-N
XLogP1.64
TPSA62.94 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500389.05
LogP ≤ 51.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;N,N-dimethylaniline;tungsten with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;N,N-dimethylaniline;tungsten?
The IUPAC name of carbon monoxide;N,N-dimethylaniline;tungsten (CID 134981716) is carbon monoxide;N,N-dimethylaniline;tungsten.
What is the SMILES notation for carbon monoxide;N,N-dimethylaniline;tungsten?
The canonical SMILES for carbon monoxide;N,N-dimethylaniline;tungsten is CN(C)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;N,N-dimethylaniline;tungsten?
The InChIKey is UMZINCJUKOFMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.3CO.W/c1-9(2)8-6-4-3-5-7-8;3*1-2;/h3-7H,1-2H3;;;;.
What are the key properties of carbon monoxide;N,N-dimethylaniline;tungsten?
carbon monoxide;N,N-dimethylaniline;tungsten has a molecular weight of 389.05 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;N,N-dimethylaniline;tungsten is sourced from PubChem (CID 134981716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).