C26H26N2 — CID 159990775
N,N-dimethylaniline;N,N-diphenylaniline (PubChem CID 159990775) has the molecular formula C26H26N2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N,N-dimethylaniline;N,N-diphenylaniline.
| Compound Name | N,N-dimethylaniline;N,N-diphenylaniline |
|---|---|
| PubChem CID | 159990775 |
| Molecular Formula | C26H26N2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N,N-dimethylaniline;N,N-diphenylaniline |
| SMILES | CN(C)c1ccccc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C8H11N/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)8-6-4-3-5-7-8/h1-15H;3-7H,1-2H3 |
| InChIKey | OGXOLXLDKJHODA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |