About acetaldehyde;N,N-dimethylaniline
acetaldehyde;N,N-dimethylaniline (PubChem CID 158535205) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is acetaldehyde;N,N-dimethylaniline.
Molecular Properties
| Compound Name | acetaldehyde;N,N-dimethylaniline |
| PubChem CID | 158535205 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | acetaldehyde;N,N-dimethylaniline |
| SMILES | CC=O.CN(C)c1ccccc1 |
| InChI | InChI=1S/C8H11N.C2H4O/c1-9(2)8-6-4-3-5-7-8;1-2-3/h3-7H,1-2H3;2H,1H3 |
| InChIKey | HNVZLBPAMBTCPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;N,N-dimethylaniline?
The IUPAC name of acetaldehyde;N,N-dimethylaniline (CID 158535205) is acetaldehyde;N,N-dimethylaniline.
What is the SMILES notation for acetaldehyde;N,N-dimethylaniline?
The canonical SMILES for acetaldehyde;N,N-dimethylaniline is CC=O.CN(C)c1ccccc1.
What is the InChIKey of acetaldehyde;N,N-dimethylaniline?
The InChIKey is HNVZLBPAMBTCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H4O/c1-9(2)8-6-4-3-5-7-8;1-2-3/h3-7H,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;N,N-dimethylaniline?
acetaldehyde;N,N-dimethylaniline has a molecular weight of 165.24 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;N,N-dimethylaniline is sourced from PubChem (CID 158535205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).