C18H27N3 — CID 174806635
aniline;4-N,4-N-dipropylbenzene-1,4-diamine (PubChem CID 174806635) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is aniline;4-N,4-N-dipropylbenzene-1,4-diamine.
| Compound Name | aniline;4-N,4-N-dipropylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 174806635 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | aniline;4-N,4-N-dipropylbenzene-1,4-diamine |
| SMILES | CCCN(CCC)c1ccc(N)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C12H20N2.C6H7N/c1-3-9-14(10-4-2)12-7-5-11(13)6-8-12;7-6-4-2-1-3-5-6/h5-8H,3-4,9-10,13H2,1-2H3;1-5H,7H2 |
| InChIKey | DWXDJPITQVWYJT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|