C28H47N5 — CID 58794851
4-N-[3-[3-(4-amino-N-propylanilino)propyl-butylamino]propyl]-4-N-propylbenzene-1,4-diamine (PubChem CID 58794851) has the molecular formula C28H47N5 and a molecular weight of 453.72 g/mol. Its IUPAC name is 4-N-[3-[3-(4-amino-N-propylanilino)propyl-butylamino]propyl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-[3-[3-(4-amino-N-propylanilino)propyl-butylamino]propyl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58794851 |
| Molecular Formula | C28H47N5 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 453.38 |
| IUPAC Name | 4-N-[3-[3-(4-amino-N-propylanilino)propyl-butylamino]propyl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCCN(CCCN(CCC)c1ccc(N)cc1)CCCN(CCC)c1ccc(N)cc1 |
| InChI | InChI=1S/C28H47N5/c1-4-7-20-31(21-8-23-32(18-5-2)27-14-10-25(29)11-15-27)22-9-24-33(19-6-3)28-16-12-26(30)13-17-28/h10-17H,4-9,18-24,29-30H2,1-3H3 |
| InChIKey | INPQEQAUAMRDIB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|