C18H24N2 — CID 18669796
1-N-phenyl-4-N,4-N-dipropylbenzene-1,4-diamine (PubChem CID 18669796) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-N-phenyl-4-N,4-N-dipropylbenzene-1,4-diamine.
| Compound Name | 1-N-phenyl-4-N,4-N-dipropylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 18669796 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-N-phenyl-4-N,4-N-dipropylbenzene-1,4-diamine |
| SMILES | CCCN(CCC)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2/c1-3-14-20(15-4-2)18-12-10-17(11-13-18)19-16-8-6-5-7-9-16/h5-13,19H,3-4,14-15H2,1-2H3 |
| InChIKey | NGEALFOUGDPJOF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|