C40H55N5 — CID 139438578
1-N-butyl-4-N-[4-[4-(butylamino)-N-[4-(dibutylamino)phenyl]anilino]phenyl]benzene-1,4-diamine (PubChem CID 139438578) has the molecular formula C40H55N5 and a molecular weight of 605.92 g/mol. Its IUPAC name is 1-N-butyl-4-N-[4-[4-(butylamino)-N-[4-(dibutylamino)phenyl]anilino]phenyl]benzene-1,4-diamine.
| Compound Name | 1-N-butyl-4-N-[4-[4-(butylamino)-N-[4-(dibutylamino)phenyl]anilino]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 139438578 |
| Molecular Formula | C40H55N5 |
| Molecular Weight | 605.92 g/mol |
| Exact Mass | 605.45 |
| IUPAC Name | 1-N-butyl-4-N-[4-[4-(butylamino)-N-[4-(dibutylamino)phenyl]anilino]phenyl]benzene-1,4-diamine |
| SMILES | CCCCNc1ccc(Nc2ccc(N(c3ccc(NCCCC)cc3)c3ccc(N(CCCC)CCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H55N5/c1-5-9-29-41-33-13-15-35(16-14-33)43-36-19-23-39(24-20-36)45(38-21-17-34(18-22-38)42-30-10-6-2)40-27-25-37(26-28-40)44(31-11-7-3)32-12-8-4/h13-28,41-43H,5-12,29-32H2,1-4H3 |
| InChIKey | NIOROUAWNFTPEN-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.92 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|