C42H60F6N4 — CID 58480980
1-N,1-N-dibutyl-4-N,4-N-bis[4-[butyl(4,4,4-trifluorobutyl)amino]phenyl]benzene-1,4-diamine (PubChem CID 58480980) has the molecular formula C42H60F6N4 and a molecular weight of 734.96 g/mol. Its IUPAC name is 1-N,1-N-dibutyl-4-N,4-N-bis[4-[butyl(4,4,4-trifluorobutyl)amino]phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,1-N-dibutyl-4-N,4-N-bis[4-[butyl(4,4,4-trifluorobutyl)amino]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58480980 |
| Molecular Formula | C42H60F6N4 |
| Molecular Weight | 734.96 g/mol |
| Exact Mass | 734.47 |
| IUPAC Name | 1-N,1-N-dibutyl-4-N,4-N-bis[4-[butyl(4,4,4-trifluorobutyl)amino]phenyl]benzene-1,4-diamine |
| SMILES | CCCCN(CCCC)c1ccc(N(c2ccc(N(CCCC)CCCC(F)(F)F)cc2)c2ccc(N(CCCC)CCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C42H60F6N4/c1-5-9-29-49(30-10-6-2)35-15-21-38(22-16-35)52(39-23-17-36(18-24-39)50(31-11-7-3)33-13-27-41(43,44)45)40-25-19-37(20-26-40)51(32-12-8-4)34-14-28-42(46,47)48/h15-26H,5-14,27-34H2,1-4H3 |
| InChIKey | CGCMTPKFBOQPSA-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.96 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|