C13H20ClIN2 — CID 142213153
4-N-butyl-4-N-(3-chloropropyl)-1-N-iodobenzene-1,4-diamine (PubChem CID 142213153) has the molecular formula C13H20ClIN2 and a molecular weight of 366.67 g/mol. Its IUPAC name is 4-N-butyl-4-N-(3-chloropropyl)-1-N-iodobenzene-1,4-diamine.
| Compound Name | 4-N-butyl-4-N-(3-chloropropyl)-1-N-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 142213153 |
| Molecular Formula | C13H20ClIN2 |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-N-butyl-4-N-(3-chloropropyl)-1-N-iodobenzene-1,4-diamine |
| SMILES | CCCCN(CCCCl)c1ccc(NI)cc1 |
| InChI | InChI=1S/C13H20ClIN2/c1-2-3-10-17(11-4-9-14)13-7-5-12(16-15)6-8-13/h5-8,16H,2-4,9-11H2,1H3 |
| InChIKey | HYBSMPVDDHIWDD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|