C14H22Cl3NO — CID 23620080
4-butoxy-N,N-bis(2-chloroethyl)aniline;hydrochloride (PubChem CID 23620080) has the molecular formula C14H22Cl3NO and a molecular weight of 326.70 g/mol. Its IUPAC name is 4-butoxy-N,N-bis(2-chloroethyl)aniline;hydrochloride.
| Compound Name | 4-butoxy-N,N-bis(2-chloroethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 23620080 |
| Molecular Formula | C14H22Cl3NO |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 4-butoxy-N,N-bis(2-chloroethyl)aniline;hydrochloride |
| SMILES | CCCCOc1ccc(N(CCCl)CCCl)cc1.Cl |
| InChI | InChI=1S/C14H21Cl2NO.ClH/c1-2-3-12-18-14-6-4-13(5-7-14)17(10-8-15)11-9-16;/h4-7H,2-3,8-12H2,1H3;1H |
| InChIKey | NMEJBFCEUCJNQY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|