C24H31NO — CID 59296825
4-[(1E,3E)-4-(4-butoxyphenyl)buta-1,3-dienyl]-N,N-diethylaniline (PubChem CID 59296825) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4-butoxyphenyl)buta-1,3-dienyl]-N,N-diethylaniline.
| Compound Name | 4-[(1E,3E)-4-(4-butoxyphenyl)buta-1,3-dienyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 59296825 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 4-[(1E,3E)-4-(4-butoxyphenyl)buta-1,3-dienyl]-N,N-diethylaniline |
| SMILES | CCCCOc1ccc(/C=C/C=C/c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H31NO/c1-4-7-20-26-24-18-14-22(15-19-24)11-9-8-10-21-12-16-23(17-13-21)25(5-2)6-3/h8-19H,4-7,20H2,1-3H3/b10-8+,11-9+ |
| InChIKey | RPKHFVMROILOTE-GFULKKFKSA-N |
| XLogP | 6.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|