C23H28O2 — CID 15500974
(2E,4E,6E,8E,10E)-11-(4-hexoxyphenyl)undeca-2,4,6,8,10-pentaenal (PubChem CID 15500974) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-11-(4-hexoxyphenyl)undeca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-11-(4-hexoxyphenyl)undeca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 15500974 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (2E,4E,6E,8E,10E)-11-(4-hexoxyphenyl)undeca-2,4,6,8,10-pentaenal |
| SMILES | CCCCCCOc1ccc(/C=C/C=C/C=C/C=C/C=C/C=O)cc1 |
| InChI | InChI=1S/C23H28O2/c1-2-3-4-14-21-25-23-18-16-22(17-19-23)15-12-10-8-6-5-7-9-11-13-20-24/h5-13,15-20H,2-4,14,21H2,1H3/b6-5+,9-7+,10-8+,13-11+,15-12+ |
| InChIKey | PRKSSQPZSQKTKS-IWBKVHHHSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|