About fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal
fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal (PubChem CID 142526280) has the molecular formula C20H32F2O3
and a molecular weight of 358.47 g/mol. Its IUPAC name is fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal.
Molecular Properties
| Compound Name | fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal |
| PubChem CID | 142526280 |
| Molecular Formula | C20H32F2O3 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal |
| SMILES | CCCCCCCOc1ccc(/C=C/C=O)cc1.CCF.COCF |
| InChI | InChI=1S/C16H22O2.C2H5FO.C2H5F/c1-2-3-4-5-6-14-18-16-11-9-15(10-12-16)8-7-13-17;1-4-2-3;1-2-3/h7-13H,2-6,14H2,1H3;2H2,1H3;2H2,1H3/b8-7+;; |
| InChIKey | AECSJAGFUJAGBG-MIIBGCIDSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal?
The IUPAC name of fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal (CID 142526280) is fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal.
What is the SMILES notation for fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal?
The canonical SMILES for fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal is CCCCCCCOc1ccc(/C=C/C=O)cc1.CCF.COCF.
What is the InChIKey of fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal?
The InChIKey is AECSJAGFUJAGBG-MIIBGCIDSA-N. The full InChI is InChI=1S/C16H22O2.C2H5FO.C2H5F/c1-2-3-4-5-6-14-18-16-11-9-15(10-12-16)8-7-13-17;1-4-2-3;1-2-3/h7-13H,2-6,14H2,1H3;2H2,1H3;2H2,1H3/b8-7+;;.
What are the key properties of fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal?
fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal has a molecular weight of 358.47 g/mol, XLogP of 5.78, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroethane;fluoro(methoxy)methane;(E)-3-(4-heptoxyphenyl)prop-2-enal is sourced from PubChem (CID 142526280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).