C20H28O3 — CID 5372840
methyl (2E,4Z)-5-(4-octoxyphenyl)penta-2,4-dienoate (PubChem CID 5372840) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl (2E,4Z)-5-(4-octoxyphenyl)penta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-(4-octoxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 5372840 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | methyl (2E,4Z)-5-(4-octoxyphenyl)penta-2,4-dienoate |
| SMILES | CCCCCCCCOc1ccc(/C=C\C=C\C(=O)OC)cc1 |
| InChI | InChI=1S/C20H28O3/c1-3-4-5-6-7-10-17-23-19-15-13-18(14-16-19)11-8-9-12-20(21)22-2/h8-9,11-16H,3-7,10,17H2,1-2H3/b11-8-,12-9+ |
| InChIKey | GIOFWIKYXZMRKU-QABOREQESA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|