C14H23NO — CID 19782341
4-hexoxy-N,N-dimethylaniline (PubChem CID 19782341) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-hexoxy-N,N-dimethylaniline.
| Compound Name | 4-hexoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19782341 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-hexoxy-N,N-dimethylaniline |
| SMILES | CCCCCCOc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H23NO/c1-4-5-6-7-12-16-14-10-8-13(9-11-14)15(2)3/h8-11H,4-7,12H2,1-3H3 |
| InChIKey | UNPSFEDEKAXCNS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|