C28H33N3O — CID 42644262
4-[(E)-2-[6-[(E)-2-(4-hexoxyphenyl)ethenyl]pyrimidin-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 42644262) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[(E)-2-[6-[(E)-2-(4-hexoxyphenyl)ethenyl]pyrimidin-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[6-[(E)-2-(4-hexoxyphenyl)ethenyl]pyrimidin-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 42644262 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-[(E)-2-[6-[(E)-2-(4-hexoxyphenyl)ethenyl]pyrimidin-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CCCCCCOc1ccc(/C=C/c2cc(/C=C/c3ccc(N(C)C)cc3)ncn2)cc1 |
| InChI | InChI=1S/C28H33N3O/c1-4-5-6-7-20-32-28-18-12-24(13-19-28)9-15-26-21-25(29-22-30-26)14-8-23-10-16-27(17-11-23)31(2)3/h8-19,21-22H,4-7,20H2,1-3H3/b14-8+,15-9+ |
| InChIKey | VYXCERHDNMXEPT-VOMDNODZSA-N |
| XLogP | 6.84 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|