C30H36FN3O — CID 164842946
4-[[2-fluoro-4-[(E)-2-(4-octoxyphenyl)ethenyl]phenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 164842946) has the molecular formula C30H36FN3O and a molecular weight of 473.64 g/mol. Its IUPAC name is 4-[[2-fluoro-4-[(E)-2-(4-octoxyphenyl)ethenyl]phenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[2-fluoro-4-[(E)-2-(4-octoxyphenyl)ethenyl]phenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164842946 |
| Molecular Formula | C30H36FN3O |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-[[2-fluoro-4-[(E)-2-(4-octoxyphenyl)ethenyl]phenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | CCCCCCCCOc1ccc(/C=C/c2ccc(/N=N/c3ccc(N(C)C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H36FN3O/c1-4-5-6-7-8-9-22-35-28-19-12-24(13-20-28)10-11-25-14-21-30(29(31)23-25)33-32-26-15-17-27(18-16-26)34(2)3/h10-21,23H,4-9,22H2,1-3H3/b11-10+,33-32+ |
| InChIKey | NHADYADPRCRLNW-WSFSBACGSA-N |
| XLogP | 9.22 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|