C34H36FN7O2 — CID 164843023
heptyl 4-[[4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]diazenyl]-3-fluorophenyl]diazenyl]benzoate (PubChem CID 164843023) has the molecular formula C34H36FN7O2 and a molecular weight of 593.71 g/mol. Its IUPAC name is heptyl 4-[[4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]diazenyl]-3-fluorophenyl]diazenyl]benzoate.
| Compound Name | heptyl 4-[[4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]diazenyl]-3-fluorophenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 164843023 |
| Molecular Formula | C34H36FN7O2 |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | heptyl 4-[[4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]diazenyl]-3-fluorophenyl]diazenyl]benzoate |
| SMILES | CCCCCCCOC(=O)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(N(C)C)cc4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C34H36FN7O2/c1-4-5-6-7-8-23-44-34(43)25-9-11-26(12-10-25)38-40-30-19-22-33(32(35)24-30)41-39-28-15-13-27(14-16-28)36-37-29-17-20-31(21-18-29)42(2)3/h9-22,24H,4-8,23H2,1-3H3/b37-36+,40-38+,41-39+ |
| InChIKey | WFVKTRDTORBBNL-ITEZJMJWSA-N |
| XLogP | 11.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|