C25H25F2N3O2 — CID 164843003
butyl 4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-2,6-difluorobenzoate (PubChem CID 164843003) has the molecular formula C25H25F2N3O2 and a molecular weight of 437.49 g/mol. Its IUPAC name is butyl 4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-2,6-difluorobenzoate.
| Compound Name | butyl 4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 164843003 |
| Molecular Formula | C25H25F2N3O2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | butyl 4-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-2,6-difluorobenzoate |
| SMILES | CCCCOC(=O)c1c(F)cc(-c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)cc1F |
| InChI | InChI=1S/C25H25F2N3O2/c1-4-5-14-32-25(31)24-22(26)15-18(16-23(24)27)17-6-8-19(9-7-17)28-29-20-10-12-21(13-11-20)30(2)3/h6-13,15-16H,4-5,14H2,1-3H3/b29-28+ |
| InChIKey | SJNNPNDCPHMWCY-ZQHSETAFSA-N |
| XLogP | 7.07 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|