C25H26F2N4O2 — CID 171415032
4-butoxy-N-[4-[[4-(dimethylamino)phenyl]diazenyl]-2-fluorophenyl]-2-fluorobenzamide (PubChem CID 171415032) has the molecular formula C25H26F2N4O2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 4-butoxy-N-[4-[[4-(dimethylamino)phenyl]diazenyl]-2-fluorophenyl]-2-fluorobenzamide.
| Compound Name | 4-butoxy-N-[4-[[4-(dimethylamino)phenyl]diazenyl]-2-fluorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 171415032 |
| Molecular Formula | C25H26F2N4O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 4-butoxy-N-[4-[[4-(dimethylamino)phenyl]diazenyl]-2-fluorophenyl]-2-fluorobenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(/N=N/c3ccc(N(C)C)cc3)cc2F)c(F)c1 |
| InChI | InChI=1S/C25H26F2N4O2/c1-4-5-14-33-20-11-12-21(22(26)16-20)25(32)28-24-13-8-18(15-23(24)27)30-29-17-6-9-19(10-7-17)31(2)3/h6-13,15-16H,4-5,14H2,1-3H3,(H,28,32)/b30-29+ |
| InChIKey | PPJIPCRQXJVHHZ-QVIHXGFCSA-N |
| XLogP | 6.88 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|