C11H12FO3- — CID 7015592
4-butoxy-2-fluorobenzoate (PubChem CID 7015592) has the molecular formula C11H12FO3- and a molecular weight of 211.21 g/mol. Its IUPAC name is 4-butoxy-2-fluorobenzoate.
| Compound Name | 4-butoxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 7015592 |
| Molecular Formula | C11H12FO3- |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-butoxy-2-fluorobenzoate |
| SMILES | CCCCOc1ccc(C(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H13FO3/c1-2-3-6-15-8-4-5-9(11(13)14)10(12)7-8/h4-5,7H,2-3,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | FDDUDQLEOGNYIT-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|