About CID 159753537
CID 159753537 (PubChem CID 159753537) has the molecular formula C56H71BBrN6O2
and a molecular weight of 950.94 g/mol.
Molecular Properties
| Compound Name | CID 159753537 |
| PubChem CID | 159753537 |
| Molecular Formula | C56H71BBrN6O2 |
| Molecular Weight | 950.94 g/mol |
| Exact Mass | 949.49 |
| IUPAC Name | — |
| SMILES | CCCCCCCCc1ccc(/N=N/c2ccc(-c3ccc(N(C)C)cc3)cc2)cc1.CCCCCCCCc1ccc(/N=N/c2ccc(Br)cc2)cc1.CN(C)c1ccc(O[B]O)cc1 |
| InChI | InChI=1S/C28H35N3.C20H25BrN2.C8H11BNO2/c1-4-5-6-7-8-9-10-23-11-17-26(18-12-23)29-30-27-19-13-24(14-20-27)25-15-21-28(22-16-25)31(2)3;1-2-3-4-5-6-7-8-17-9-13-19(14-10-17)22-23-20-15-11-18(21)12-16-20;1-10(2)7-3-5-8(6-4-7)12-9-11/h11-22H,4-10H2,1-3H3;9-16H,2-8H2,1H3;3-6,11H,1-2H3/b30-29+;23-22+; |
| InChIKey | QCUUJKVRJPHPNJ-FEIQWABQSA-N |
| XLogP | 17.16 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 950.94 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159753537 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159753537?
The IUPAC name of CID 159753537 (CID 159753537) is not available.
What is the SMILES notation for CID 159753537?
The canonical SMILES for CID 159753537 is CCCCCCCCc1ccc(/N=N/c2ccc(-c3ccc(N(C)C)cc3)cc2)cc1.CCCCCCCCc1ccc(/N=N/c2ccc(Br)cc2)cc1.CN(C)c1ccc(O[B]O)cc1.
What is the InChIKey of CID 159753537?
The InChIKey is QCUUJKVRJPHPNJ-FEIQWABQSA-N. The full InChI is InChI=1S/C28H35N3.C20H25BrN2.C8H11BNO2/c1-4-5-6-7-8-9-10-23-11-17-26(18-12-23)29-30-27-19-13-24(14-20-27)25-15-21-28(22-16-25)31(2)3;1-2-3-4-5-6-7-8-17-9-13-19(14-10-17)22-23-20-15-11-18(21)12-16-20;1-10(2)7-3-5-8(6-4-7)12-9-11/h11-22H,4-10H2,1-3H3;9-16H,2-8H2,1H3;3-6,11H,1-2H3/b30-29+;23-22+;.
What are the key properties of CID 159753537?
CID 159753537 has a molecular weight of 950.94 g/mol, XLogP of 17.16, 23 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159753537 is sourced from PubChem (CID 159753537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).