C72H68Br2N2Si — CID 164836340
N-(4-bromophenyl)-N-[4-[[4-[N-(4-bromophenyl)-4-(4-hexylphenyl)anilino]phenyl]-diphenylsilyl]phenyl]-4-(4-hexylphenyl)aniline (PubChem CID 164836340) has the molecular formula C72H68Br2N2Si and a molecular weight of 1149.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[4-[[4-[N-(4-bromophenyl)-4-(4-hexylphenyl)anilino]phenyl]-diphenylsilyl]phenyl]-4-(4-hexylphenyl)aniline.
| Compound Name | N-(4-bromophenyl)-N-[4-[[4-[N-(4-bromophenyl)-4-(4-hexylphenyl)anilino]phenyl]-diphenylsilyl]phenyl]-4-(4-hexylphenyl)aniline |
|---|---|
| PubChem CID | 164836340 |
| Molecular Formula | C72H68Br2N2Si |
| Molecular Weight | 1149.24 g/mol |
| Exact Mass | 1146.35 |
| IUPAC Name | N-(4-bromophenyl)-N-[4-[[4-[N-(4-bromophenyl)-4-(4-hexylphenyl)anilino]phenyl]-diphenylsilyl]phenyl]-4-(4-hexylphenyl)aniline |
| SMILES | CCCCCCc1ccc(-c2ccc(N(c3ccc(Br)cc3)c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccc(N(c5ccc(Br)cc5)c5ccc(-c6ccc(CCCCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C72H68Br2N2Si/c1-3-5-7-11-17-55-23-27-57(28-24-55)59-31-39-63(40-32-59)75(65-43-35-61(73)36-44-65)67-47-51-71(52-48-67)77(69-19-13-9-14-20-69,70-21-15-10-16-22-70)72-53-49-68(50-54-72)76(66-45-37-62(74)38-46-66)64-41-33-60(34-42-64)58-29-25-56(26-30-58)18-12-8-6-4-2/h9-10,13-16,19-54H,3-8,11-12,17-18H2,1-2H3 |
| InChIKey | PPVOHSOEAPCGQH-UHFFFAOYSA-N |
| XLogP | 19.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.24 |
| LogP ≤ 5 | 19.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|