C18H18N2O4 — CID 136794477
butyl 4-[(3-formyl-4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 136794477) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is butyl 4-[(3-formyl-4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | butyl 4-[(3-formyl-4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 136794477 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | butyl 4-[(3-formyl-4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(/N=N/c2ccc(O)c(C=O)c2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-2-3-10-24-18(23)13-4-6-15(7-5-13)19-20-16-8-9-17(22)14(11-16)12-21/h4-9,11-12,22H,2-3,10H2,1H3/b20-19+ |
| InChIKey | NSBTXJUYQPMABK-FMQUCBEESA-N |
| XLogP | 4.58 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|