C24H31N3O3 — CID 136745238
ethyl 4-[[4-hydroxy-3-(octyliminomethyl)phenyl]diazenyl]benzoate (PubChem CID 136745238) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 4-[[4-hydroxy-3-(octyliminomethyl)phenyl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[4-hydroxy-3-(octyliminomethyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 136745238 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | ethyl 4-[[4-hydroxy-3-(octyliminomethyl)phenyl]diazenyl]benzoate |
| SMILES | CCCCCCCC/N=C/c1cc(/N=N/c2ccc(C(=O)OCC)cc2)ccc1O |
| InChI | InChI=1S/C24H31N3O3/c1-3-5-6-7-8-9-16-25-18-20-17-22(14-15-23(20)28)27-26-21-12-10-19(11-13-21)24(29)30-4-2/h10-15,17-18,28H,3-9,16H2,1-2H3/b25-18+,27-26+ |
| InChIKey | IOUYRYKADSXPBK-KSVDJQIDSA-N |
| XLogP | 6.76 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|