C32H44N2O6 — CID 136777660
hexyl 3-[4-[(5-hexoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate (PubChem CID 136777660) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is hexyl 3-[4-[(5-hexoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate.
| Compound Name | hexyl 3-[4-[(5-hexoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 136777660 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | hexyl 3-[4-[(5-hexoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate |
| SMILES | CCCCCCOC(=O)c1ccc(O)c(/C=N/CCCC/N=C/c2cc(C(=O)OCCCCCC)ccc2O)c1 |
| InChI | InChI=1S/C32H44N2O6/c1-3-5-7-11-19-39-31(37)25-13-15-29(35)27(21-25)23-33-17-9-10-18-34-24-28-22-26(14-16-30(28)36)32(38)40-20-12-8-6-4-2/h13-16,21-24,35-36H,3-12,17-20H2,1-2H3/b33-23+,34-24+ |
| InChIKey | WSTKNMNDWPXTMK-IENBMRAWSA-N |
| XLogP | 6.89 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|