C28H36N2O6 — CID 136778125
butyl 3-[4-[(5-butoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate (PubChem CID 136778125) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is butyl 3-[4-[(5-butoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate.
| Compound Name | butyl 3-[4-[(5-butoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 136778125 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | butyl 3-[4-[(5-butoxycarbonyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]-4-hydroxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(O)c(/C=N/CCCC/N=C/c2cc(C(=O)OCCCC)ccc2O)c1 |
| InChI | InChI=1S/C28H36N2O6/c1-3-5-15-35-27(33)21-9-11-25(31)23(17-21)19-29-13-7-8-14-30-20-24-18-22(10-12-26(24)32)28(34)36-16-6-4-2/h9-12,17-20,31-32H,3-8,13-16H2,1-2H3/b29-19+,30-20+ |
| InChIKey | VTNPLXPANOSHBI-CZYCKNNWSA-N |
| XLogP | 5.33 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|