C11H13NO4 — CID 172566365
methyl 4-hydroxy-3-(2-hydroxyethyliminomethyl)benzoate (PubChem CID 172566365) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 4-hydroxy-3-(2-hydroxyethyliminomethyl)benzoate.
| Compound Name | methyl 4-hydroxy-3-(2-hydroxyethyliminomethyl)benzoate |
|---|---|
| PubChem CID | 172566365 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl 4-hydroxy-3-(2-hydroxyethyliminomethyl)benzoate |
| SMILES | COC(=O)c1ccc(O)c(/C=N/CCO)c1 |
| InChI | InChI=1S/C11H13NO4/c1-16-11(15)8-2-3-10(14)9(6-8)7-12-4-5-13/h2-3,6-7,13-14H,4-5H2,1H3/b12-7+ |
| InChIKey | OZFQZBPCIPHCFT-KPKJPENVSA-N |
| XLogP | 0.59 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|