C18H18N2O5 — CID 136719139
methyl 4-hydroxy-3-[2-[(2-hydroxybenzoyl)amino]ethyliminomethyl]benzoate (PubChem CID 136719139) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 4-hydroxy-3-[2-[(2-hydroxybenzoyl)amino]ethyliminomethyl]benzoate.
| Compound Name | methyl 4-hydroxy-3-[2-[(2-hydroxybenzoyl)amino]ethyliminomethyl]benzoate |
|---|---|
| PubChem CID | 136719139 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 4-hydroxy-3-[2-[(2-hydroxybenzoyl)amino]ethyliminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(O)c(/C=N/CCNC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C18H18N2O5/c1-25-18(24)12-6-7-15(21)13(10-12)11-19-8-9-20-17(23)14-4-2-3-5-16(14)22/h2-7,10-11,21-22H,8-9H2,1H3,(H,20,23)/b19-11+ |
| InChIKey | MRPHFSQIDQFGHF-YBFXNURJSA-N |
| XLogP | 1.73 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|