C25H25N5O4 — CID 135405887
2-N,6-N-bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]pyridine-2,6-dicarboxamide (PubChem CID 135405887) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-N,6-N-bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 135405887 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-N,6-N-bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCC/N=C/c1ccccc1O)c1cccc(C(=O)NCC/N=C/c2ccccc2O)n1 |
| InChI | InChI=1S/C25H25N5O4/c31-22-10-3-1-6-18(22)16-26-12-14-28-24(33)20-8-5-9-21(30-20)25(34)29-15-13-27-17-19-7-2-4-11-23(19)32/h1-11,16-17,31-32H,12-15H2,(H,28,33)(H,29,34)/b26-16+,27-17+ |
| InChIKey | FRZYHMBSATYULI-CTVDDJEBSA-N |
| XLogP | 2.19 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|