C17H31N3O4Si — CID 136753245
2-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyliminomethyl]phenol (PubChem CID 136753245) has the molecular formula C17H31N3O4Si and a molecular weight of 369.54 g/mol. Its IUPAC name is 2-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyliminomethyl]phenol.
| Compound Name | 2-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 136753245 |
| Molecular Formula | C17H31N3O4Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyliminomethyl]phenol |
| SMILES | CO[Si](CCCNCCNCC/N=C/c1ccccc1O)(OC)OC |
| InChI | InChI=1S/C17H31N3O4Si/c1-22-25(23-2,24-3)14-6-9-18-10-11-19-12-13-20-15-16-7-4-5-8-17(16)21/h4-5,7-8,15,18-19,21H,6,9-14H2,1-3H3/b20-15+ |
| InChIKey | QJOLSBZEAZWMGQ-HMMYKYKNSA-N |
| XLogP | 1.26 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|