C20H34N4O4Si — CID 135476248
2-[2-[2-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propylamino]ethylamino]ethyliminomethyl]phenol (PubChem CID 135476248) has the molecular formula C20H34N4O4Si and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[2-[2-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propylamino]ethylamino]ethyliminomethyl]phenol.
| Compound Name | 2-[2-[2-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propylamino]ethylamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135476248 |
| Molecular Formula | C20H34N4O4Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[2-[2-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propylamino]ethylamino]ethyliminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/CCNCCNCCC[Si]12OCCN(CCO1)CCO2 |
| InChI | InChI=1S/C20H34N4O4Si/c25-20-5-2-1-4-19(20)18-23-10-9-22-8-7-21-6-3-17-29-26-14-11-24(12-15-27-29)13-16-28-29/h1-2,4-5,18,21-22,25H,3,6-17H2/b23-18+ |
| InChIKey | IBMOTKRRZBWMTP-PTGBLXJZSA-N |
| XLogP | 0.70 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|