C22H28CoN4O2+2 — CID 3937622
bis(2-[2-(aziridin-1-yl)ethyliminomethyl]phenol);cobalt(2+) (PubChem CID 3937622) has the molecular formula C22H28CoN4O2+2 and a molecular weight of 439.43 g/mol. Its IUPAC name is bis(2-[2-(aziridin-1-yl)ethyliminomethyl]phenol);cobalt(2+).
| Compound Name | bis(2-[2-(aziridin-1-yl)ethyliminomethyl]phenol);cobalt(2+) |
|---|---|
| PubChem CID | 3937622 |
| Molecular Formula | C22H28CoN4O2+2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | bis(2-[2-(aziridin-1-yl)ethyliminomethyl]phenol);cobalt(2+) |
| SMILES | Oc1ccccc1/C=N/CCN1CC1.Oc1ccccc1C=NCCN1CC1.[Co+2] |
| InChI | InChI=1S/2C11H14N2O.Co/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,14H,5-8H2;/q;;+2/b12-9+;; |
| InChIKey | IKNYHDMDZWRBLI-ANOGCNOSSA-N |
| XLogP | 2.25 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|