C29H30N4O3 — CID 136903530
12-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]-2-methylidene-9,12,15-triazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),8,15,17(21),18-octaene-21,22-diol (PubChem CID 136903530) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 12-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]-2-methylidene-9,12,15-triazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),8,15,17(21),18-octaene-21,22-diol.
| Compound Name | 12-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]-2-methylidene-9,12,15-triazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),8,15,17(21),18-octaene-21,22-diol |
|---|---|
| PubChem CID | 136903530 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 12-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]-2-methylidene-9,12,15-triazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),8,15,17(21),18-octaene-21,22-diol |
| SMILES | C=C1c2cccc(c2O)/C=N\CCN(CC/N=C/c2ccccc2O)CC/N=C\c2cccc1c2O |
| InChI | InChI=1S/C29H30N4O3/c1-21-25-9-4-7-23(28(25)35)19-31-13-16-33(15-12-30-18-22-6-2-3-11-27(22)34)17-14-32-20-24-8-5-10-26(21)29(24)36/h2-11,18-20,34-36H,1,12-17H2/b30-18+,31-19-,32-20- |
| InChIKey | WHCADGVQNMMURN-YGAVPXKBSA-N |
| XLogP | 4.14 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|