C13H21NO6Si — CID 135927797
4-(3-trimethoxysilylpropyliminomethyl)benzene-1,2,3-triol (PubChem CID 135927797) has the molecular formula C13H21NO6Si and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-(3-trimethoxysilylpropyliminomethyl)benzene-1,2,3-triol.
| Compound Name | 4-(3-trimethoxysilylpropyliminomethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135927797 |
| Molecular Formula | C13H21NO6Si |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-(3-trimethoxysilylpropyliminomethyl)benzene-1,2,3-triol |
| SMILES | CO[Si](CCC/N=C/c1ccc(O)c(O)c1O)(OC)OC |
| InChI | InChI=1S/C13H21NO6Si/c1-18-21(19-2,20-3)8-4-7-14-9-10-5-6-11(15)13(17)12(10)16/h5-6,9,15-17H,4,7-8H2,1-3H3/b14-9+ |
| InChIKey | RROLVPGVGDXCGB-NTEUORMPSA-N |
| XLogP | 1.49 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|