C19H28N2O4Si — CID 136818505
5-(3-triethoxysilylpropyliminomethyl)quinolin-8-ol (PubChem CID 136818505) has the molecular formula C19H28N2O4Si and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-(3-triethoxysilylpropyliminomethyl)quinolin-8-ol.
| Compound Name | 5-(3-triethoxysilylpropyliminomethyl)quinolin-8-ol |
|---|---|
| PubChem CID | 136818505 |
| Molecular Formula | C19H28N2O4Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 5-(3-triethoxysilylpropyliminomethyl)quinolin-8-ol |
| SMILES | CCO[Si](CCC/N=C/c1ccc(O)c2ncccc12)(OCC)OCC |
| InChI | InChI=1S/C19H28N2O4Si/c1-4-23-26(24-5-2,25-6-3)14-8-12-20-15-16-10-11-18(22)19-17(16)9-7-13-21-19/h7,9-11,13,15,22H,4-6,8,12,14H2,1-3H3/b20-15+ |
| InChIKey | KMOFJGPBMFUOMV-HMMYKYKNSA-N |
| XLogP | 3.80 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|