C17H29NO4Si — CID 67729195
1-(4-methoxyphenyl)-N-(3-triethoxysilylpropyl)methanimine (PubChem CID 67729195) has the molecular formula C17H29NO4Si and a molecular weight of 339.51 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(3-triethoxysilylpropyl)methanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-(3-triethoxysilylpropyl)methanimine |
|---|---|
| PubChem CID | 67729195 |
| Molecular Formula | C17H29NO4Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(3-triethoxysilylpropyl)methanimine |
| SMILES | CCO[Si](CCC/N=C/c1ccc(OC)cc1)(OCC)OCC |
| InChI | InChI=1S/C17H29NO4Si/c1-5-20-23(21-6-2,22-7-3)14-8-13-18-15-16-9-11-17(19-4)12-10-16/h9-12,15H,5-8,13-14H2,1-4H3/b18-15+ |
| InChIKey | LBXLMTQHTSMKNT-OBGWFSINSA-N |
| XLogP | 3.55 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|