C24H40O6Si — CID 142687822
(2E)-2-[(4-methoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid (PubChem CID 142687822) has the molecular formula C24H40O6Si and a molecular weight of 452.66 g/mol. Its IUPAC name is (2E)-2-[(4-methoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid.
| Compound Name | (2E)-2-[(4-methoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid |
|---|---|
| PubChem CID | 142687822 |
| Molecular Formula | C24H40O6Si |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2E)-2-[(4-methoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid |
| SMILES | CCO[Si](CCCCCCCC/C(=C\c1ccc(OC)cc1)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C24H40O6Si/c1-5-28-31(29-6-2,30-7-3)19-13-11-9-8-10-12-14-22(24(25)26)20-21-15-17-23(27-4)18-16-21/h15-18,20H,5-14,19H2,1-4H3,(H,25,26)/b22-20+ |
| InChIKey | ZHUSEEMCSHEPBS-LSDHQDQOSA-N |
| XLogP | 5.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|