C30H42O9Si — CID 142687771
(2E)-2-[[4-(3,4-dimethoxybenzoyl)oxyphenyl]methylidene]-8-triethoxysilyloctanoic acid (PubChem CID 142687771) has the molecular formula C30H42O9Si and a molecular weight of 574.74 g/mol. Its IUPAC name is (2E)-2-[[4-(3,4-dimethoxybenzoyl)oxyphenyl]methylidene]-8-triethoxysilyloctanoic acid.
| Compound Name | (2E)-2-[[4-(3,4-dimethoxybenzoyl)oxyphenyl]methylidene]-8-triethoxysilyloctanoic acid |
|---|---|
| PubChem CID | 142687771 |
| Molecular Formula | C30H42O9Si |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (2E)-2-[[4-(3,4-dimethoxybenzoyl)oxyphenyl]methylidene]-8-triethoxysilyloctanoic acid |
| SMILES | CCO[Si](CCCCCC/C(=C\c1ccc(OC(=O)c2ccc(OC)c(OC)c2)cc1)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C30H42O9Si/c1-6-36-40(37-7-2,38-8-3)20-12-10-9-11-13-24(29(31)32)21-23-14-17-26(18-15-23)39-30(33)25-16-19-27(34-4)28(22-25)35-5/h14-19,21-22H,6-13,20H2,1-5H3,(H,31,32)/b24-21+ |
| InChIKey | OZWGWEVBUXITJH-DARPEHSRSA-N |
| XLogP | 6.39 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|