C26H44O6Si — CID 142687772
(2E)-2-[(4-propoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid (PubChem CID 142687772) has the molecular formula C26H44O6Si and a molecular weight of 480.72 g/mol. Its IUPAC name is (2E)-2-[(4-propoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid.
| Compound Name | (2E)-2-[(4-propoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid |
|---|---|
| PubChem CID | 142687772 |
| Molecular Formula | C26H44O6Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (2E)-2-[(4-propoxyphenyl)methylidene]-10-triethoxysilyldecanoic acid |
| SMILES | CCCOc1ccc(/C=C(\CCCCCCCC[Si](OCC)(OCC)OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C26H44O6Si/c1-5-20-29-25-18-16-23(17-19-25)22-24(26(27)28)15-13-11-9-10-12-14-21-33(30-6-2,31-7-3)32-8-4/h16-19,22H,5-15,20-21H2,1-4H3,(H,27,28)/b24-22+ |
| InChIKey | RXERHUKDEQZOTL-ZNTNEXAZSA-N |
| XLogP | 6.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|