C32H56O7Si — CID 142687780
(2E)-2-[(3-decoxy-4-methoxyphenyl)methylidene]-8-triethoxysilyloctanoic acid (PubChem CID 142687780) has the molecular formula C32H56O7Si and a molecular weight of 580.88 g/mol. Its IUPAC name is (2E)-2-[(3-decoxy-4-methoxyphenyl)methylidene]-8-triethoxysilyloctanoic acid.
| Compound Name | (2E)-2-[(3-decoxy-4-methoxyphenyl)methylidene]-8-triethoxysilyloctanoic acid |
|---|---|
| PubChem CID | 142687780 |
| Molecular Formula | C32H56O7Si |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | (2E)-2-[(3-decoxy-4-methoxyphenyl)methylidene]-8-triethoxysilyloctanoic acid |
| SMILES | CCCCCCCCCCOc1cc(/C=C(\CCCCCC[Si](OCC)(OCC)OCC)C(=O)O)ccc1OC |
| InChI | InChI=1S/C32H56O7Si/c1-6-10-11-12-13-14-16-19-24-36-31-27-28(22-23-30(31)35-5)26-29(32(33)34)21-18-15-17-20-25-40(37-7-2,38-8-3)39-9-4/h22-23,26-27H,6-21,24-25H2,1-5H3,(H,33,34)/b29-26+ |
| InChIKey | VUZZNGWMJSAYRH-PBBVDAKRSA-N |
| XLogP | 8.68 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|