C34H59NO9Si — CID 140988134
6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(3-methoxy-4-octoxyphenyl)prop-2-enoate (PubChem CID 140988134) has the molecular formula C34H59NO9Si and a molecular weight of 653.93 g/mol. Its IUPAC name is 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(3-methoxy-4-octoxyphenyl)prop-2-enoate.
| Compound Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(3-methoxy-4-octoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 140988134 |
| Molecular Formula | C34H59NO9Si |
| Molecular Weight | 653.93 g/mol |
| Exact Mass | 653.40 |
| IUPAC Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexyl (E)-3-(3-methoxy-4-octoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)OCCCCCCOC(=O)NCCC[Si](OCC)(OCC)OCC)cc1OC |
| InChI | InChI=1S/C34H59NO9Si/c1-6-10-11-12-13-16-25-39-31-22-20-30(29-32(31)38-5)21-23-33(36)40-26-17-14-15-18-27-41-34(37)35-24-19-28-45(42-7-2,43-8-3)44-9-4/h20-23,29H,6-19,24-28H2,1-5H3,(H,35,37)/b23-21+ |
| InChIKey | RLSDYQUENNUJAO-XTQSDGFTSA-N |
| XLogP | 7.72 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.93 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|