C28H47NO9Si — CID 54339385
methyl 3-[4-ethoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate (PubChem CID 54339385) has the molecular formula C28H47NO9Si and a molecular weight of 569.77 g/mol. Its IUPAC name is methyl 3-[4-ethoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-ethoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54339385 |
| Molecular Formula | C28H47NO9Si |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | methyl 3-[4-ethoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(C=CC(=O)OC)cc1OCCCCCCOC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C28H47NO9Si/c1-6-33-25-17-15-24(16-18-27(30)32-5)23-26(25)34-20-12-10-11-13-21-35-28(31)29-19-14-22-39(36-7-2,37-8-3)38-9-4/h15-18,23H,6-14,19-22H2,1-5H3,(H,29,31) |
| InChIKey | TXVUGLUBPDICKQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|