C22H36O7Si — CID 54025550
methyl 3-[4-ethoxy-3-(4-triethoxysilylbutoxy)phenyl]prop-2-enoate (PubChem CID 54025550) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is methyl 3-[4-ethoxy-3-(4-triethoxysilylbutoxy)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-ethoxy-3-(4-triethoxysilylbutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54025550 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl 3-[4-ethoxy-3-(4-triethoxysilylbutoxy)phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(C=CC(=O)OC)cc1OCCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C22H36O7Si/c1-6-25-20-14-12-19(13-15-22(23)24-5)18-21(20)26-16-10-11-17-30(27-7-2,28-8-3)29-9-4/h12-15,18H,6-11,16-17H2,1-5H3 |
| InChIKey | LBXJHPKZPQGXTI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|