C25H40O8Si — CID 67576318
3-[4-butoxy-3-(6-triethoxysilylhexanoyloxy)phenyl]prop-2-enoic acid (PubChem CID 67576318) has the molecular formula C25H40O8Si and a molecular weight of 496.67 g/mol. Its IUPAC name is 3-[4-butoxy-3-(6-triethoxysilylhexanoyloxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-butoxy-3-(6-triethoxysilylhexanoyloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67576318 |
| Molecular Formula | C25H40O8Si |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 3-[4-butoxy-3-(6-triethoxysilylhexanoyloxy)phenyl]prop-2-enoic acid |
| SMILES | CCCCOc1ccc(C=CC(=O)O)cc1OC(=O)CCCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C25H40O8Si/c1-5-9-18-29-22-16-14-21(15-17-24(26)27)20-23(22)33-25(28)13-11-10-12-19-34(30-6-2,31-7-3)32-8-4/h14-17,20H,5-13,18-19H2,1-4H3,(H,26,27) |
| InChIKey | NURSGCLUQBHAIK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|